cas: 461-92-7 — see every product listed under this CAS number, including other names
1,1,1-Trifluoro-6-methylheptane-2,4-dione 99+% (CAS 461-92-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A119355-250mg |
| cas | 461-92-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 487.19 Pln | |
| Ambeed | 10g | 904.38 Pln |
| purity | 99+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A119355 |
1,1,1-trifluoro-6-methylheptane-2,4-dione (CAS 461-92-7) is a chemical compound with the molecular formula C8H11F3O2 and a molecular weight of 196.17 g/mol. IUPAC name: 1,1,1-trifluoro-6-methylheptane-2,4-dione. InChIKey: XWBVTGFPQXBNOZ-UHFFFAOYSA-N.
| Molecular formula | C8H11F3O2 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | 1,1,1-trifluoro-6-methylheptane-2,4-dione |
| InChIKey | XWBVTGFPQXBNOZ-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)