cas: 3393-77-9 — see every product listed under this CAS number, including other names
1,1′-Thiobis[4-methoxybenzene], 98%, 98% (CAS 3393-77-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I7PB-250mg |
| cas | 3393-77-9 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 592.40 Pln | |
| Chemat | 1g | 1293.20 Pln | |
| Chemat | 5g | 4979.60 Pln | |
| Chemat | 100mg | 381.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-methoxy-4-(4-methoxyphenyl)sulfanylbenzene (CAS 3393-77-9) is a chemical compound with the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. IUPAC name: 1-methoxy-4-(4-methoxyphenyl)sulfanylbenzene. InChIKey: UKHKZGJCPDWXQY-UHFFFAOYSA-N.
| Molecular formula | C14H14O2S |
|---|---|
| Molecular weight | 246.33 g/mol |
| IUPAC name | 1-methoxy-4-(4-methoxyphenyl)sulfanylbenzene |
| InChIKey | UKHKZGJCPDWXQY-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)SC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)