cas: 1486409-21-5 — see every product listed under this CAS number, including other names
1,1-DIMETHYL 3-OXOCYCLOBUTANE-1,1-DICARBOXYLATE, 97% (CAS 1486409-21-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467553-1G |
| cas | 1486409-21-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 627.92 Pln | |
| Fluorochem | 5g | 2543.91 Pln | |
| Fluorochem | 10g | 4912.87 Pln | |
| Fluorochem | 25g | 10473.41 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Dimethyl 3-oxocyclobutane-1,1-dicarboxylate (CAS 1486409-21-5) is a chemical compound with the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. IUPAC name: dimethyl 3-oxocyclobutane-1,1-dicarboxylate. InChIKey: NHQJSSOZLZSFFQ-UHFFFAOYSA-N.
| Molecular formula | C8H10O5 |
|---|---|
| Molecular weight | 186.16 g/mol |
| IUPAC name | dimethyl 3-oxocyclobutane-1,1-dicarboxylate |
| InChIKey | NHQJSSOZLZSFFQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CC(=O)C1)C(=O)OC |
Computed by PubChem (NCBI)