cas: 1486409-21-5 — see every product listed under this CAS number, including other names
1,1-Dimethyl 3-oxocyclobutane-1,1-dicarboxylate, 97%, 97% (CAS 1486409-21-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 15g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112L41-250mg |
| cas | 1486409-21-5 |
| size | 250mg |
| availability | 225g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 395.60 Pln | |
| Chemat | 5g | 1552.40 Pln | |
| Chemat | 10g | 2982.80 Pln | |
| Chemat | 15g | 4307.60 Pln | |
| Chemat | 25g | 6338.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Dimethyl 3-oxocyclobutane-1,1-dicarboxylate (CAS 1486409-21-5) is a chemical compound with the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. IUPAC name: dimethyl 3-oxocyclobutane-1,1-dicarboxylate. InChIKey: NHQJSSOZLZSFFQ-UHFFFAOYSA-N.
| Molecular formula | C8H10O5 |
|---|---|
| Molecular weight | 186.16 g/mol |
| IUPAC name | dimethyl 3-oxocyclobutane-1,1-dicarboxylate |
| InChIKey | NHQJSSOZLZSFFQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CC(=O)C1)C(=O)OC |
Computed by PubChem (NCBI)