CAS 87330-27-6 appears in our catalog under these names: 1,10-Phenanthroline-4,7(1H,10H)-dione, 95%, 95%, 1,10-Phenanthroline-4,7(1H,10H)-dione, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 10g.
1,10-dihydro-1,10-phenanthroline-4,7-dione (CAS 87330-27-6) is a chemical compound with the molecular formula C12H8N2O2 and a molecular weight of 212.20 g/mol. IUPAC name: 1,10-dihydro-1,10-phenanthroline-4,7-dione. InChIKey: SLIBCJURSADKPV-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O2 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 1,10-dihydro-1,10-phenanthroline-4,7-dione |
| InChIKey | SLIBCJURSADKPV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C1C(=O)C=CN3)NC=CC2=O |
Computed by PubChem (NCBI)