Products 349644-67-3
CAS 349644-67-3 appears in our catalog under these names: N-(3-Cyanophenyl)-2-furamide, 95%, N-(3-Cyanophenyl)furan-2-carboxamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 2,5g.
N-(3-cyanophenyl)furan-2-carboxamide (CAS 349644-67-3) is a chemical compound with the molecular formula C12H8N2O2 and a molecular weight of 212.20 g/mol. IUPAC name: N-(3-cyanophenyl)furan-2-carboxamide. InChIKey: STNDAQWJZCSIOJ-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O2 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | N-(3-cyanophenyl)furan-2-carboxamide |
| InChIKey | STNDAQWJZCSIOJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)C2=CC=CO2)C#N |
Computed by PubChem (NCBI)