CAS 5690-46-0 appears in our catalog under these names: 2-Amino-2,3-dihydro-1h-benzo[de]isoquinoline-1,3-dione, 95%, 2-Amino-2,3-dihydro-1H-benzo(de)isoquinoline-1,3-dione, 2-Amino-1H-benzo[de]isoquinoline-1,3(2H)-dione 95%, 2-Amino-1H-benzo[de]isoquinoline-1,3(2H)-dione, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g, 10g, 100mg, 250mg.
2-aminobenzo[de]isoquinoline-1,3-dione (CAS 5690-46-0) is a chemical compound with the molecular formula C12H8N2O2 and a molecular weight of 212.20 g/mol. IUPAC name: 2-aminobenzo[de]isoquinoline-1,3-dione. InChIKey: HXJBFRDWVHNPAS-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O2 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 2-aminobenzo[de]isoquinoline-1,3-dione |
| InChIKey | HXJBFRDWVHNPAS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C(=O)N(C(=O)C3=CC=C2)N |
Computed by PubChem (NCBI)