CAS 14093-97-1 appears in our catalog under these names: 2-(Furan-2-yl)-5-phenyl-1,3,4-oxadiazole, 95%, 2-Phenyl-5-(2-furyl)-1,3,4-oxadiazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g.
2-(furan-2-yl)-5-phenyl-1,3,4-oxadiazole (CAS 14093-97-1) is a chemical compound with the molecular formula C12H8N2O2 and a molecular weight of 212.20 g/mol. IUPAC name: 2-(furan-2-yl)-5-phenyl-1,3,4-oxadiazole. InChIKey: RUMMFSKZAJIGOV-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O2 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 2-(furan-2-yl)-5-phenyl-1,3,4-oxadiazole |
| InChIKey | RUMMFSKZAJIGOV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(O2)C3=CC=CO3 |
Computed by PubChem (NCBI)