Products 1932-08-7
CAS 1932-08-7 appears in our catalog under these names: N-[(1Z,2E)-2-(hydroxyimino)acenaphthylen-1-ylidene]hydroxylamine, 95%, Acenaphthenequinone Dioxime, Acenaphthenequinone Dioxime, acenaphthylene-1,2-dione dioxime, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 5g, 1g, 250mg.
N-(2-hydroxyiminoacenaphthylen-1-ylidene)hydroxylamine (CAS 1932-08-7) is a chemical compound with the molecular formula C12H8N2O2 and a molecular weight of 212.20 g/mol. IUPAC name: N-(2-hydroxyiminoacenaphthylen-1-ylidene)hydroxylamine. InChIKey: ZBHVKJFVTXXTEQ-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O2 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | N-(2-hydroxyiminoacenaphthylen-1-ylidene)hydroxylamine |
| InChIKey | ZBHVKJFVTXXTEQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C(=NO)C(=NO)C3=CC=C2 |
Computed by PubChem (NCBI)