CAS 31438-22-9 appears in our catalog under these names: 1-Nitro-9h-carbazole, 95%, 1-Nitro-9H-carbazole, 97%, 1–Nitro–9H–carbazole, 1-Nitro-9H-carbazole 95%, 1-Nitro-9H-carbazole, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
1-nitro-9H-carbazole (CAS 31438-22-9) is a chemical compound with the molecular formula C12H8N2O2 and a molecular weight of 212.20 g/mol. IUPAC name: 1-nitro-9H-carbazole. InChIKey: VYOKOQDVBBWPKO-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O2 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 1-nitro-9H-carbazole |
| InChIKey | VYOKOQDVBBWPKO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C(=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)