CAS 885-12-1 appears in our catalog under these names: 2-(1H-Pyrrol-1-yl)isoindoline-1,3-dione, 95%, 2–(1H–Pyrrol–1–yl)isoindoline–1,3–dione, 2-(1H-pyrrol-1-yl)-1H-isoindole-1,3(2H)-dione, 97%, 97%, 2-(1H-Pyrrol-1-yl)isoindoline-1,3-dione, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 250mg.
2-pyrrol-1-ylisoindole-1,3-dione (CAS 885-12-1) is a chemical compound with the molecular formula C12H8N2O2 and a molecular weight of 212.20 g/mol. IUPAC name: 2-pyrrol-1-ylisoindole-1,3-dione. InChIKey: ZNEDESIYADUHFJ-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O2 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 2-pyrrol-1-ylisoindole-1,3-dione |
| InChIKey | ZNEDESIYADUHFJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)N3C=CC=C3 |
Computed by PubChem (NCBI)