CAS 58457-37-7 appears in our catalog under these names: 1H-Pyrrolo[3,2-h]quinoline-2-carboxylic acid, 95%, 1H-Pyrrolo[3,2-h]quinoline-2-carboxylic acid 98%, 1H-Pyrrolo[3,2-h]quinoline-2-carboxylic acid, 98%, 98%, 1H-Pyrrolo[3,2-h]quinoline-2-carboxylic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
1H-pyrrolo[3,2-h]quinoline-2-carboxylic acid (CAS 58457-37-7) is a chemical compound with the molecular formula C12H8N2O2 and a molecular weight of 212.20 g/mol. IUPAC name: 1H-pyrrolo[3,2-h]quinoline-2-carboxylic acid. InChIKey: NKRJTXAQMCUSEC-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O2 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 1H-pyrrolo[3,2-h]quinoline-2-carboxylic acid |
| InChIKey | NKRJTXAQMCUSEC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C(C=C2)C=C(N3)C(=O)O)N=C1 |
Computed by PubChem (NCBI)