cas: 30450-62-5 — see every product listed under this CAS number, including other names
1,2,3,4-Tetrahydro-7-nitroquinoline (CAS 30450-62-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F079351-1G |
| cas | 30450-62-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 138.51 Pln | |
| Fluorochem | 10g | 190.58 Pln | |
| Fluorochem | 25g | 351.98 Pln | |
| Fluorochem | 100g | 1174.60 Pln |
| delivery time | 2-3 weeks |
|---|
7-nitro-1,2,3,4-tetrahydroquinoline (CAS 30450-62-5) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 7-nitro-1,2,3,4-tetrahydroquinoline. InChIKey: WSWMGHRLUYADNA-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 7-nitro-1,2,3,4-tetrahydroquinoline |
| InChIKey | WSWMGHRLUYADNA-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2)[N+](=O)[O-])NC1 |
Computed by PubChem (NCBI)