cas: 41994-51-8 — see every product listed under this CAS number, including other names
1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid hydrochloride, 97% (CAS 41994-51-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F237411-1G |
| cas | 41994-51-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 5g | 294.71 Pln | |
| Fluorochem | 10g | 497.76 Pln | |
| Fluorochem | 25g | 549.82 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;hydrochloride (CAS 41994-51-8) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;hydrochloride. InChIKey: FXHCFPUEIDRTMR-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;hydrochloride |
| InChIKey | FXHCFPUEIDRTMR-UHFFFAOYSA-N |
| SMILES | C1C(NCC2=CC=CC=C21)C(=O)O.Cl |
Computed by PubChem (NCBI)