CAS 77497-95-1 appears in our catalog under these names: (S)-1,2,3,4-Tetrahydro-3-isoquinolinecarboxylic acid hydrochloride, 95%, (3S)-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid hydrochloride. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 5g, 100g, 1g.
(3S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;hydrochloride (CAS 77497-95-1) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: (3S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;hydrochloride. InChIKey: FXHCFPUEIDRTMR-FVGYRXGTSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | (3S)-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;hydrochloride |
| InChIKey | FXHCFPUEIDRTMR-FVGYRXGTSA-N |
| SMILES | C1[C@H](NCC2=CC=CC=C21)C(=O)O.Cl |
Computed by PubChem (NCBI)