1,2-Benzenedicarboxylic acid, 3-methoxy-, 96%, 96%
cas: 14963-97-4 — see every product listed under this CAS number, including other names
1,2-Benzenedicarboxylic acid, 3-methoxy-, 96%, 96% (CAS 14963-97-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118XZT-100mg |
| cas | 14963-97-4 |
| size | 100mg |
| availability | 25g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 443.60 Pln | |
| Chemat | 10g | 750.80 Pln | |
| Chemat | 25g | 1437.20 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
3-methoxyphthalic acid (CAS 14963-97-4) is a chemical compound with the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. IUPAC name: 3-methoxyphthalic acid. InChIKey: DULQZGQVLHMCAU-UHFFFAOYSA-N.
| Molecular formula | C9H8O5 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 3-methoxyphthalic acid |
| InChIKey | DULQZGQVLHMCAU-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-methoxyphthalic acid, Benzenedicarboxylic acid, methoxy-, 1,2-Benzenedicarboxylic acid, 3-methoxy-, methoxyphthalic acid, 3-methoxybenzene-1,2-dioic acid, 3-Methoxy-phthalic acid, 3-methoxybenzene-1,2-dicarboxylicacid, 3-methoxy-1,2-Benzenedicarboxylic acid, 3-methoxyphthalica, 3-methoxyphthalicacid