cas: 13402-32-9 — see every product listed under this CAS number, including other names
1,3-Dibromo-2-nitrobenzene, 98%, 98% (CAS 13402-32-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110GGW-25g |
| cas | 13402-32-9 |
| size | 25g |
| availability | 160g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 568.40 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 165.20 Pln | |
| Chemat | 10g | 266.00 Pln | |
| Chemat | 100g | 2075.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,3-dibromo-2-nitrobenzene (CAS 13402-32-9) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 1,3-dibromo-2-nitrobenzene. InChIKey: HATHNBZPXBWLFB-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 1,3-dibromo-2-nitrobenzene |
| InChIKey | HATHNBZPXBWLFB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)