CAS 2016-99-1 appears in our catalog under these names: 2,6–dibromopyridine–4–carboxylic acid, 2,6-Dibromoisonicotinic acid 96%, 2,6-Dibromoisonicotinic acid, 97%, 97%, 2,6-Dibromopyridine-4-carboxylic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 250mg, 1g, 10g, 100g, 50g, 250g.
2,6-dibromopyridine-4-carboxylic acid (CAS 2016-99-1) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 2,6-dibromopyridine-4-carboxylic acid. InChIKey: AULQTVXAKNKCCA-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 2,6-dibromopyridine-4-carboxylic acid |
| InChIKey | AULQTVXAKNKCCA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1Br)Br)C(=O)O |
Computed by PubChem (NCBI)