Products 29312-99-0
CAS 29312-99-0 appears in our catalog under these names: 2,5-Dibromonicotinic acid 97%, 2,5-Dibromonicotinic Acid, 97%, 97%, 2,5-Dibromonicotinic acid, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 50g.
2,5-dibromopyridine-3-carboxylic acid (CAS 29312-99-0) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 2,5-dibromopyridine-3-carboxylic acid. InChIKey: BRPWRSWAXHWEPS-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 2,5-dibromopyridine-3-carboxylic acid |
| InChIKey | BRPWRSWAXHWEPS-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)O)Br)Br |
Computed by PubChem (NCBI)