Products 55304-85-3
CAS 55304-85-3 appears in our catalog under these names: 2,6-Dibromo-3-pyridinecarboxylic acid 97%, 2,6-Dibromopyridine-3-carboxylic acid, 97%, 2,6-Dibromo-3-pyridinecarboxylic acid, 97%, 97%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
2,6-dibromopyridine-3-carboxylic acid (CAS 55304-85-3) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 2,6-dibromopyridine-3-carboxylic acid. InChIKey: JOASPXJXGMCEOX-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 2,6-dibromopyridine-3-carboxylic acid |
| InChIKey | JOASPXJXGMCEOX-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(=O)O)Br)Br |
Computed by PubChem (NCBI)