CAS 6311-60-0 appears in our catalog under these names: 1,3–Dibromo–5–nitrobenzene, 1,3-Dibromo-5-nitrobenzene, >98.0%(GC), 1,3-Dibromo-5-nitrobenzene 95%, 1,3-dibromo-5-nitrobenzene, 95%, 95%, 1,3-Dibromo-5-nitrobenzene, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 500g, 1000g, 1kg.
1,3-dibromo-5-nitrobenzene (CAS 6311-60-0) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 1,3-dibromo-5-nitrobenzene. InChIKey: ZWBHGBWABMAWOV-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 1,3-dibromo-5-nitrobenzene |
| InChIKey | ZWBHGBWABMAWOV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Br)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)