CAS 1020056-98-7 appears in our catalog under these names: 2,3-Dibromoisonicotinic acid, 98%+(HPLC),RG, 98%+(HPLC),RG, 2,3-Dibromopyridine-4-carboxylic acid, 95%, 2,3-Dibromoisonicotinic acid, 97%, 2，3–Dibromoisonicotinic acid, 2,3-Dibromopyridine-4-carboxylic acid, 97% . Offered by: Chemat, Combi-blocks, AmBeed, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 250mg, 1g, 100mg, 5g.
2,3-dibromopyridine-4-carboxylic acid (CAS 1020056-98-7) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 2,3-dibromopyridine-4-carboxylic acid. InChIKey: ICISUZSRQHUJKX-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 2,3-dibromopyridine-4-carboxylic acid |
| InChIKey | ICISUZSRQHUJKX-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1C(=O)O)Br)Br |
Computed by PubChem (NCBI)