Products 73027-77-7
CAS 73027-77-7 appears in our catalog under these names: 4,6-Dibromonicotinic acid, 95%, 4,6-Dibromonicotinic acid, 98%, 4,6-Dibromonicotinic acid, 4，6-Dibromonicotinic acid, 97%, 97%, 4,6-Dibromonicotinic acid, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 10g, 5g, 0,5g, 500mg.
4,6-dibromopyridine-3-carboxylic acid (CAS 73027-77-7) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 4,6-dibromopyridine-3-carboxylic acid. InChIKey: GHQFPXZHIYMGLM-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 4,6-dibromopyridine-3-carboxylic acid |
| InChIKey | GHQFPXZHIYMGLM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Br)C(=O)O)Br |
Computed by PubChem (NCBI)