CAS 29241-64-3 appears in our catalog under these names: 5,6-Dibromopyridine-3-carboxylic acid, 95%, 5,6-Dibromonicotinic Acid, >95% (HPLC), 5,6-Dibromonicotinic acid 98%, 5,6-Dibromonicotinic acid, 98%, 98%, 5,6-Dibromonicotinic acid, 97%. Offered by: Combi-blocks, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 10g, 500mg, 100g, 250mg, 50g.
5,6-dibromopyridine-3-carboxylic acid (CAS 29241-64-3) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 5,6-dibromopyridine-3-carboxylic acid. InChIKey: ABBCIGFWDCOGEQ-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 5,6-dibromopyridine-3-carboxylic acid |
| InChIKey | ABBCIGFWDCOGEQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Br)Br)C(=O)O |
Computed by PubChem (NCBI)