cas: 89692-81-9 — see every product listed under this CAS number, including other names
1,3-Dichloro-5-methyl-2-nitrobenzene 95% (CAS 89692-81-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A361755-250mg |
| cas | 89692-81-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 1015.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A361755 |
1,3-dichloro-5-methyl-2-nitrobenzene (CAS 89692-81-9) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 1,3-dichloro-5-methyl-2-nitrobenzene. InChIKey: POAILBXQTJDSFV-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 1,3-dichloro-5-methyl-2-nitrobenzene |
| InChIKey | POAILBXQTJDSFV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)