cas: 19064-24-5 — see every product listed under this CAS number, including other names
1,3-Difluoro-2-nitrobenzene 98% (CAS 19064-24-5) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A180962-1000g |
| cas | 19064-24-5 |
| size | 1000g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 5003.94 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 275.81 Pln | |
| Ambeed | 100g | 654.06 Pln | |
| Ambeed | 500g | 2973.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A180962 |
1,3-difluoro-2-nitrobenzene (CAS 19064-24-5) is a chemical compound with the molecular formula C6H3F2NO2 and a molecular weight of 159.09 g/mol. IUPAC name: 1,3-difluoro-2-nitrobenzene. InChIKey: SSNCMIDZGFCTST-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO2 |
|---|---|
| Molecular weight | 159.09 g/mol |
| IUPAC name | 1,3-difluoro-2-nitrobenzene |
| InChIKey | SSNCMIDZGFCTST-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)