cas: 19064-24-5 — see every product listed under this CAS number, including other names
2,6-Difluoronitrobenzene, 98% (CAS 19064-24-5) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Thermo Scientific (Acros), Sigma-Aldrich.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 397340050 |
| cas | 19064-24-5 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 895.34 Pln | |
| Sigma-Aldrich | 5G | 571.00 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
1,3-difluoro-2-nitrobenzene (CAS 19064-24-5) is a chemical compound with the molecular formula C6H3F2NO2 and a molecular weight of 159.09 g/mol. IUPAC name: 1,3-difluoro-2-nitrobenzene. InChIKey: SSNCMIDZGFCTST-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO2 |
|---|---|
| Molecular weight | 159.09 g/mol |
| IUPAC name | 1,3-difluoro-2-nitrobenzene |
| InChIKey | SSNCMIDZGFCTST-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)