cas: 19064-24-5 — see every product listed under this CAS number, including other names
1,3-Difluoro-2-nitrobenzene, 97%, 97% (CAS 19064-24-5) is a chemical reagent available from Chemat. Available pack sizes: 5kg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113EP3-5kg |
| cas | 19064-24-5 |
| size | 5kg |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5kg | 12648.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 146.00 Pln | |
| Chemat | 50g | 227.60 Pln | |
| Chemat | 100g | 371.60 Pln | |
| Chemat | 250g | 818.00 Pln | |
| Chemat | 500g | 1579.20 Pln | |
| Chemat | 1kg | 2939.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1,3-difluoro-2-nitrobenzene (CAS 19064-24-5) is a chemical compound with the molecular formula C6H3F2NO2 and a molecular weight of 159.09 g/mol. IUPAC name: 1,3-difluoro-2-nitrobenzene. InChIKey: SSNCMIDZGFCTST-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO2 |
|---|---|
| Molecular weight | 159.09 g/mol |
| IUPAC name | 1,3-difluoro-2-nitrobenzene |
| InChIKey | SSNCMIDZGFCTST-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)