cas: 19064-24-5 — see every product listed under this CAS number, including other names
2,6-Difluoronitrobenzene, 97% (CAS 19064-24-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040207-1G |
| cas | 19064-24-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 133.30 Pln | |
| Fluorochem | 25g | 221.81 Pln | |
| Fluorochem | 100g | 638.33 Pln | |
| Fluorochem | 500g | 2970.85 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
1,3-difluoro-2-nitrobenzene (CAS 19064-24-5) is a chemical compound with the molecular formula C6H3F2NO2 and a molecular weight of 159.09 g/mol. IUPAC name: 1,3-difluoro-2-nitrobenzene. InChIKey: SSNCMIDZGFCTST-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO2 |
|---|---|
| Molecular weight | 159.09 g/mol |
| IUPAC name | 1,3-difluoro-2-nitrobenzene |
| InChIKey | SSNCMIDZGFCTST-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)