CAS 1392277-06-3 appears in our catalog under these names: 1,3-Dioxo-2,3-dihydro-1H-isoindol-2-yl cyclopropanecarboxylate, 1,3-Dioxoisoindolin-2-yl Cyclopropanecarboxylate, 98%, 98%, 1,3-DIOXOISOINDOLIN-2-YL CYCLOPROPANECARBOXYLATE, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 25g, 100mg.
(1,3-dioxoisoindol-2-yl) cyclopropanecarboxylate (CAS 1392277-06-3) is a chemical compound with the molecular formula C12H9NO4 and a molecular weight of 231.20 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) cyclopropanecarboxylate. InChIKey: BDRFYZKZLYMXLC-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) cyclopropanecarboxylate |
| InChIKey | BDRFYZKZLYMXLC-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)ON2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)