CAS 293761-91-8 is the registry number for 3-(Furan-2-amido)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-(furan-2-carbonylamino)benzoic acid (CAS 293761-91-8) is a chemical compound with the molecular formula C12H9NO4 and a molecular weight of 231.20 g/mol. IUPAC name: 3-(furan-2-carbonylamino)benzoic acid. InChIKey: BXEQLEUNAJFOEP-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | 3-(furan-2-carbonylamino)benzoic acid |
| InChIKey | BXEQLEUNAJFOEP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)C2=CC=CO2)C(=O)O |
Computed by PubChem (NCBI)