CAS 40349-49-3 is the registry number for 4-(2,5-Dioxo-2,5-dihydro-pyrrol-1-yl)-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 4-(2,5-dioxopyrrol-1-yl)benzoate (CAS 40349-49-3) is a chemical compound with the molecular formula C12H9NO4 and a molecular weight of 231.20 g/mol. IUPAC name: methyl 4-(2,5-dioxopyrrol-1-yl)benzoate. InChIKey: MCQKOFWQPCQEBG-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | methyl 4-(2,5-dioxopyrrol-1-yl)benzoate |
| InChIKey | MCQKOFWQPCQEBG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)N2C(=O)C=CC2=O |
Computed by PubChem (NCBI)