CAS 356576-44-8 is the registry number for 2-Cyclopropyl-1,3-dioxoisoindoline-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-cyclopropyl-1,3-dioxoisoindole-5-carboxylic acid (CAS 356576-44-8) is a chemical compound with the molecular formula C12H9NO4 and a molecular weight of 231.20 g/mol. IUPAC name: 2-cyclopropyl-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: POBKDVVNFBAOBJ-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | 2-cyclopropyl-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | POBKDVVNFBAOBJ-UHFFFAOYSA-N |
| SMILES | C1CC1N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)