Products 356576-44-8

CAS 356576-44-8 is the registry number for 2-Cyclopropyl-1,3-dioxoisoindoline-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-cyclopropyl-1,3-dioxoisoindole-5-carboxylic acid (CAS 356576-44-8) is a chemical compound with the molecular formula C12H9NO4 and a molecular weight of 231.20 g/mol. IUPAC name: 2-cyclopropyl-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: POBKDVVNFBAOBJ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9NO4
Molecular weight231.20 g/mol
IUPAC name2-cyclopropyl-1,3-dioxoisoindole-5-carboxylic acid
InChIKeyPOBKDVVNFBAOBJ-UHFFFAOYSA-N
SMILESC1CC1N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O

Computed by PubChem (NCBI)