Products 89278-25-1
CAS 89278-25-1 appears in our catalog under these names: 4-Nitro-1-naphthaleneacetic acid, 4-Nitro-1-naphthalene acetic acid, 95%, 2-(4-Nitronaphthalen-1-yl)acetic acid, 97%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 500mg, 1000mg, 1g, 5g.
2-(4-nitronaphthalen-1-yl)acetic acid (CAS 89278-25-1) is a chemical compound with the molecular formula C12H9NO4 and a molecular weight of 231.20 g/mol. IUPAC name: 2-(4-nitronaphthalen-1-yl)acetic acid. InChIKey: ZQKCRZQJMZQAOY-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | 2-(4-nitronaphthalen-1-yl)acetic acid |
| InChIKey | ZQKCRZQJMZQAOY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2[N+](=O)[O-])CC(=O)O |
Computed by PubChem (NCBI)