CAS 54582-58-0 appears in our catalog under these names: 4-(2-Nitrophenoxy)phenol, 98%, 4-(2-NItrophenoxy)phenol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-(2-nitrophenoxy)phenol (CAS 54582-58-0) is a chemical compound with the molecular formula C12H9NO4 and a molecular weight of 231.20 g/mol. IUPAC name: 4-(2-nitrophenoxy)phenol. InChIKey: HCPZTWLWRNMUJJ-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | 4-(2-nitrophenoxy)phenol |
| InChIKey | HCPZTWLWRNMUJJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])OC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)