CAS 41441-42-3 appears in our catalog under these names: 2-Allyl-1,3-dioxoisoindoline-5-carboxylic acid, 95%, 1,3-Dioxo-2-(prop-2-en-1-yl)-2,3-dihydro-1H-isoindole-5-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
1,3-dioxo-2-prop-2-enylisoindole-5-carboxylic acid (CAS 41441-42-3) is a chemical compound with the molecular formula C12H9NO4 and a molecular weight of 231.20 g/mol. IUPAC name: 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylic acid. InChIKey: WVOXIWJWBBJKCZ-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylic acid |
| InChIKey | WVOXIWJWBBJKCZ-UHFFFAOYSA-N |
| SMILES | C=CCN1C(=O)C2=C(C1=O)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)