CAS 511239-02-4 appears in our catalog under these names: 1-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1h-pyrrole-2,5-dione, 95%, 1-(2,3-Dihydrobenzo(b)(1,4)dioxin-6-yl)-1H-pyrrole-2,5-dione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 10g, 5g.
1-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrole-2,5-dione (CAS 511239-02-4) is a chemical compound with the molecular formula C12H9NO4 and a molecular weight of 231.20 g/mol. IUPAC name: 1-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrole-2,5-dione. InChIKey: LRCFBRUAUCWMAU-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrole-2,5-dione |
| InChIKey | LRCFBRUAUCWMAU-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)N3C(=O)C=CC3=O |
Computed by PubChem (NCBI)