cas: 1355620-88-0 — see every product listed under this CAS number, including other names
1,4,7,10-Tetraoxacyclododecino[2,3-g]quinolin-15(12h)-one, 2,3,5,6,8,9-hexahydro-, 97%, 97% (CAS 1355620-88-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110XGH-100mg |
| cas | 1355620-88-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 381.20 Pln | |
| Chemat | 250mg | 491.60 Pln | |
| Chemat | 500mg | 774.80 Pln | |
| Chemat | 1g | 1130.00 Pln | |
| Chemat | 5g | 3506.00 Pln | |
| Chemat | 10g | 5944.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,5,8,11-tetraoxa-15-azatricyclo[10.8.0.014,19]icosa-1(12),13,16,19-tetraen-18-one (CAS 1355620-88-0) is a chemical compound with the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. IUPAC name: 2,5,8,11-tetraoxa-15-azatricyclo[10.8.0.014,19]icosa-1(12),13,16,19-tetraen-18-one. InChIKey: ZCMWZZBZYPCAKJ-UHFFFAOYSA-N.
| Molecular formula | C15H17NO5 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | 2,5,8,11-tetraoxa-15-azatricyclo[10.8.0.014,19]icosa-1(12),13,16,19-tetraen-18-one |
| InChIKey | ZCMWZZBZYPCAKJ-UHFFFAOYSA-N |
| SMILES | C1COCCOC2=C(C=C3C(=O)C=CNC3=C2)OCCO1 |
Computed by PubChem (NCBI)