cas: 5870-37-1 — see every product listed under this CAS number, including other names
1,4-Benzenedicarboxylic acid, 2,5-dihydroxy-, diMethyl ester, 98% (CAS 5870-37-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F863681-5G |
| cas | 5870-37-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 206.20 Pln | |
| Fluorochem | 25g | 653.95 Pln | |
| Fluorochem | 100g | 2450.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Dimethyl 2,5-dihydroxybenzene-1,4-dicarboxylate (CAS 5870-37-1) is a chemical compound with the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. IUPAC name: dimethyl 2,5-dihydroxybenzene-1,4-dicarboxylate. InChIKey: WABMHCVYKWKAAH-UHFFFAOYSA-N.
| Molecular formula | C10H10O6 |
|---|---|
| Molecular weight | 226.18 g/mol |
| IUPAC name | dimethyl 2,5-dihydroxybenzene-1,4-dicarboxylate |
| InChIKey | WABMHCVYKWKAAH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1O)C(=O)OC)O |
Computed by PubChem (NCBI)