CAS 84955-26-0 is the registry number for Dimethyl 3,4-dihydroxyphthalate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl 3,4-dihydroxybenzene-1,2-dicarboxylate (CAS 84955-26-0) is a chemical compound with the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. IUPAC name: dimethyl 3,4-dihydroxybenzene-1,2-dicarboxylate. InChIKey: IVUYABGPNIFMQC-UHFFFAOYSA-N.
| Molecular formula | C10H10O6 |
|---|---|
| Molecular weight | 226.18 g/mol |
| IUPAC name | dimethyl 3,4-dihydroxybenzene-1,2-dicarboxylate |
| InChIKey | IVUYABGPNIFMQC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)O)O)C(=O)OC |
Computed by PubChem (NCBI)