Products 84955-26-0

CAS 84955-26-0 is the registry number for Dimethyl 3,4-dihydroxyphthalate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Dimethyl 3,4-dihydroxybenzene-1,2-dicarboxylate (CAS 84955-26-0) is a chemical compound with the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. IUPAC name: dimethyl 3,4-dihydroxybenzene-1,2-dicarboxylate. InChIKey: IVUYABGPNIFMQC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10O6
Molecular weight226.18 g/mol
IUPAC namedimethyl 3,4-dihydroxybenzene-1,2-dicarboxylate
InChIKeyIVUYABGPNIFMQC-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C(=C(C=C1)O)O)C(=O)OC

Computed by PubChem (NCBI)