cas: 499769-88-9 — see every product listed under this CAS number, including other names
1,4-Benzodioxane-5-boronic acid, 95%, 95% (CAS 499769-88-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DAE0-100mg |
| cas | 499769-88-9 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 500mg | 434.00 Pln | |
| Chemat | 1g | 578.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,3-dihydro-1,4-benzodioxin-5-ylboronic acid (CAS 499769-88-9) is a chemical compound with the molecular formula C8H9BO4 and a molecular weight of 179.97 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxin-5-ylboronic acid. InChIKey: MCWPMXPNJVZOTP-UHFFFAOYSA-N.
| Molecular formula | C8H9BO4 |
|---|---|
| Molecular weight | 179.97 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxin-5-ylboronic acid |
| InChIKey | MCWPMXPNJVZOTP-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)OCCO2)(O)O |
Computed by PubChem (NCBI)