CAS 1256346-18-5 appears in our catalog under these names: 5-Borono-2-methylbenzoic acid, 97%, 5-Borono-2-methylbenzoic acid, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 25mg.
5-borono-2-methylbenzoic acid (CAS 1256346-18-5) is a chemical compound with the molecular formula C8H9BO4 and a molecular weight of 179.97 g/mol. IUPAC name: 5-borono-2-methylbenzoic acid. InChIKey: YFXACZJIMXASRO-UHFFFAOYSA-N.
| Molecular formula | C8H9BO4 |
|---|---|
| Molecular weight | 179.97 g/mol |
| IUPAC name | 5-borono-2-methylbenzoic acid |
| InChIKey | YFXACZJIMXASRO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C)C(=O)O)(O)O |
Computed by PubChem (NCBI)