cas: 164014-95-3 — see every product listed under this CAS number, including other names
1,4-Benzodioxane-6-boronic acid 96% (CAS 164014-95-3) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A656685-1000g |
| cas | 164014-95-3 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 13041.75 Pln | |
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 181.25 Pln | |
| Ambeed | 10g | 275.81 Pln | |
| Ambeed | 25g | 576.19 Pln | |
| Ambeed | 100g | 2094.75 Pln | |
| Ambeed | 500g | 8180.13 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A656685 |
2,3-dihydro-1,4-benzodioxin-6-ylboronic acid (CAS 164014-95-3) is a chemical compound with the molecular formula C8H9BO4 and a molecular weight of 179.97 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxin-6-ylboronic acid. InChIKey: SQDUGGGBJXULJR-UHFFFAOYSA-N.
| Molecular formula | C8H9BO4 |
|---|---|
| Molecular weight | 179.97 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxin-6-ylboronic acid |
| InChIKey | SQDUGGGBJXULJR-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)OCCO2)(O)O |
Computed by PubChem (NCBI)