CAS 4442-54-0 appears in our catalog under these names: 3,4-Ethylenedioxybenzoic Acid, 1,4–Benzodioxane–6–carboxylic acid, 2,3-Dihydro-1,4-benzodioxine-6-carboxylic acid, 95% , 1,4-Benzodioxane-6-carboxylic Acid, >98.0%(GC)(T), 1,4-BENZODIOXANE-6-CARBOXYLIC ACID, 97%. Offered by: TRC, GLPBio, Thermo Scientific, TCI, Sigma-Aldrich. Available pack sizes: 100g, 25g, 5g, 250MG, 1g, 10g, 10 g, 5 g.
2,3-dihydro-1,4-benzodioxine-6-carboxylic acid (CAS 4442-54-0) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxine-6-carboxylic acid. InChIKey: JWZQJTGQFHIRFQ-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxine-6-carboxylic acid |
| InChIKey | JWZQJTGQFHIRFQ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)