CAS 367519-88-8 appears in our catalog under these names: 3-Formyl-5-methoxybenzoic acid, 97%, 3-Formyl-5-methoxybenzoic acid, 3-Formyl-5-methoxybenzoic acid 97%, 3-Formyl-5-methoxybenzoic acid, 97%, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 2g, 10g, 25g, 100mg, 250mg.
3-formyl-5-methoxybenzoic acid (CAS 367519-88-8) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 3-formyl-5-methoxybenzoic acid. InChIKey: DYXJFLKQBAPWDM-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 3-formyl-5-methoxybenzoic acid |
| InChIKey | DYXJFLKQBAPWDM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C(=O)O)C=O |
Computed by PubChem (NCBI)