CAS 70918-54-6 appears in our catalog under these names: (S)-1,4-Benzodioxane-2-carboxylic acid, 95%, (S)–1,4–Benzodioxane–2–carboxylic acid, (S)-1,4-Benzodioxane-2-carboxylic acid 97%, (S)-1,4-Benzodioxane-2-carboxylic acid, 98%, 98%, (S)-2,3-Dihydro-benzo[1,4]dioxine-2-carboxylic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
(3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid (CAS 70918-54-6) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid. InChIKey: HMBHAQMOBKLWRX-QMMMGPOBSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid |
| InChIKey | HMBHAQMOBKLWRX-QMMMGPOBSA-N |
| SMILES | C1[C@H](OC2=CC=CC=C2O1)C(=O)O |
Computed by PubChem (NCBI)