CAS 62653-25-2 appears in our catalog under these names: 3A,4,7,7A-Tetrahydro-4-methyl-4,7-epoxyisobenzofuran-1,3-dione, 95%, 4-Methyl-3a,4,7,7a-tetrahydro-4,7-epoxyisobenzofuran-1,3-dione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
1-methyl-4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (CAS 62653-25-2) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 1-methyl-4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione. InChIKey: CFLSTTHDYSASGE-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 1-methyl-4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| InChIKey | CFLSTTHDYSASGE-UHFFFAOYSA-N |
| SMILES | CC12C=CC(O1)C3C2C(=O)OC3=O |
Computed by PubChem (NCBI)