CAS 2613-89-0 appears in our catalog under these names: 2-phenylpropanedioic acid, 97%, Phenylmalonic acid, Phenylmalonic acid, Phenylmalonic Acid, >95.0%(GC)(T), 2-Phenylmalonic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 5g, 500g, 100g, 25g, 0,5kg, 1kg, 2kg, 10g.
2-phenylpropanedioic acid (CAS 2613-89-0) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 2-phenylpropanedioic acid. InChIKey: WWYDYZMNFQIYPT-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 2-phenylpropanedioic acid |
| InChIKey | WWYDYZMNFQIYPT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)