CAS 4442-53-9 appears in our catalog under these names: 1,4-Benzodioxan-5-carboxylic acid, 98%, 1,4-Benzodioxane-5-carboxylic Acid, >98.0%(GC)(T), 2,3-Dihydrobenzo[b][1,4]dioxine-5-carboxylic acid 97%, 2,3-dihydrobenzo[b][1,4]dioxine-5-carboxylic acid, 97%, 97%, 2,3-Dihydrobenzo[1,4]dioxine-5-carboxylic acid, 98%. Offered by: Combi-blocks, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 500g, 5g, 1g, 100g, 10g.
2,3-dihydro-1,4-benzodioxine-5-carboxylic acid (CAS 4442-53-9) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxine-5-carboxylic acid. InChIKey: VCLSWKVAHAJSFL-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxine-5-carboxylic acid |
| InChIKey | VCLSWKVAHAJSFL-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=CC=C2O1)C(=O)O |
Computed by PubChem (NCBI)