Products 37748-09-7
CAS 37748-09-7 appears in our catalog under these names: 2-(3-Formylphenoxy)acetic acid, 95%, (3–formylphenoxy)acetic acid, 3-Formylphenoxyacetic acid, 97%, m-Formylphenoxyacetic acid, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem, Chemat. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 50g.
2-(3-formylphenoxy)acetic acid (CAS 37748-09-7) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 2-(3-formylphenoxy)acetic acid. InChIKey: KHBBQMHTRDEPCR-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 2-(3-formylphenoxy)acetic acid |
| InChIKey | KHBBQMHTRDEPCR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(=O)O)C=O |
Computed by PubChem (NCBI)